C14H19N3O2 — CID 177160618
ethyl 6-(2-methylpyrimidin-5-yl)-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 177160618) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl 6-(2-methylpyrimidin-5-yl)-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | ethyl 6-(2-methylpyrimidin-5-yl)-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 177160618 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | ethyl 6-(2-methylpyrimidin-5-yl)-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CCOC(=O)N1CC2(CC(c3cnc(C)nc3)C2)C1 |
| InChI | InChI=1S/C14H19N3O2/c1-3-19-13(18)17-8-14(9-17)4-11(5-14)12-6-15-10(2)16-7-12/h6-7,11H,3-5,8-9H2,1-2H3 |
| InChIKey | CDMYKLPBILXRQT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |