C20H29N3O3 — CID 118294937
ethyl 2-[4-(3-hydroxy-2-pyridinyl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate (PubChem CID 118294937) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl 2-[4-(3-hydroxy-2-pyridinyl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate.
| Compound Name | ethyl 2-[4-(3-hydroxy-2-pyridinyl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate |
|---|---|
| PubChem CID | 118294937 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | ethyl 2-[4-(3-hydroxy-2-pyridinyl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC(N3CCC(c4ncccc4O)CC3)C2)C1 |
| InChI | InChI=1S/C20H29N3O3/c1-2-26-19(25)23-11-7-20(14-23)12-16(13-20)22-9-5-15(6-10-22)18-17(24)4-3-8-21-18/h3-4,8,15-16,24H,2,5-7,9-14H2,1H3 |
| InChIKey | HPECJEGCQXPHQU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |