C22H32N2O2S — CID 126511819
ethyl 2-(4-benzylsulfanylpiperidin-1-yl)-6-azaspiro[3.4]octane-6-carboxylate (PubChem CID 126511819) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is ethyl 2-(4-benzylsulfanylpiperidin-1-yl)-6-azaspiro[3.4]octane-6-carboxylate.
| Compound Name | ethyl 2-(4-benzylsulfanylpiperidin-1-yl)-6-azaspiro[3.4]octane-6-carboxylate |
|---|---|
| PubChem CID | 126511819 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | ethyl 2-(4-benzylsulfanylpiperidin-1-yl)-6-azaspiro[3.4]octane-6-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC(N3CCC(SCc4ccccc4)CC3)C2)C1 |
| InChI | InChI=1S/C22H32N2O2S/c1-2-26-21(25)24-13-10-22(17-24)14-19(15-22)23-11-8-20(9-12-23)27-16-18-6-4-3-5-7-18/h3-7,19-20H,2,8-17H2,1H3 |
| InChIKey | RABIONYOXRBOCJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |