C19H32N2O3 — CID 140909628
ethyl 2-(4-butanoylpiperidin-1-yl)-6-azaspiro[3.4]octane-6-carboxylate (PubChem CID 140909628) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is ethyl 2-(4-butanoylpiperidin-1-yl)-6-azaspiro[3.4]octane-6-carboxylate.
| Compound Name | ethyl 2-(4-butanoylpiperidin-1-yl)-6-azaspiro[3.4]octane-6-carboxylate |
|---|---|
| PubChem CID | 140909628 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | ethyl 2-(4-butanoylpiperidin-1-yl)-6-azaspiro[3.4]octane-6-carboxylate |
| SMILES | CCCC(=O)C1CCN(C2CC3(CCN(C(=O)OCC)C3)C2)CC1 |
| InChI | InChI=1S/C19H32N2O3/c1-3-5-17(22)15-6-9-20(10-7-15)16-12-19(13-16)8-11-21(14-19)18(23)24-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | JKIWYMYESXQLJP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |