C17H26ClFN2O2 — CID 90089445
ethyl 2-[4-(1-chloroethenyl)-4-fluoropiperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate (PubChem CID 90089445) has the molecular formula C17H26ClFN2O2 and a molecular weight of 344.86 g/mol. Its IUPAC name is ethyl 2-[4-(1-chloroethenyl)-4-fluoropiperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate.
| Compound Name | ethyl 2-[4-(1-chloroethenyl)-4-fluoropiperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate |
|---|---|
| PubChem CID | 90089445 |
| Molecular Formula | C17H26ClFN2O2 |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethyl 2-[4-(1-chloroethenyl)-4-fluoropiperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate |
| SMILES | C=C(Cl)C1(F)CCN(C2CC3(CCN(C(=O)OCC)C3)C2)CC1 |
| InChI | InChI=1S/C17H26ClFN2O2/c1-3-23-15(22)21-7-4-16(12-21)10-14(11-16)20-8-5-17(19,6-9-20)13(2)18/h14H,2-12H2,1H3 |
| InChIKey | JPBNTCZYWGDWNW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |