C21H35N3O3 — CID 73437708
ethyl 2-[4-(cyclobutylmethylcarbamoyl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate (PubChem CID 73437708) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is ethyl 2-[4-(cyclobutylmethylcarbamoyl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate.
| Compound Name | ethyl 2-[4-(cyclobutylmethylcarbamoyl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate |
|---|---|
| PubChem CID | 73437708 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | ethyl 2-[4-(cyclobutylmethylcarbamoyl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC(N3CCC(C(=O)NCC4CCC4)CC3)C2)C1 |
| InChI | InChI=1S/C21H35N3O3/c1-2-27-20(26)24-11-8-21(15-24)12-18(13-21)23-9-6-17(7-10-23)19(25)22-14-16-4-3-5-16/h16-18H,2-15H2,1H3,(H,22,25) |
| InChIKey | WBVBGTVQQSFCEQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |