C17H28N6O2 — CID 118295269
ethyl 2-[4-(1-methyltetrazol-5-yl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate (PubChem CID 118295269) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl 2-[4-(1-methyltetrazol-5-yl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate.
| Compound Name | ethyl 2-[4-(1-methyltetrazol-5-yl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate |
|---|---|
| PubChem CID | 118295269 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | ethyl 2-[4-(1-methyltetrazol-5-yl)piperidin-1-yl]-6-azaspiro[3.4]octane-6-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC(N3CCC(c4nnnn4C)CC3)C2)C1 |
| InChI | InChI=1S/C17H28N6O2/c1-3-25-16(24)23-9-6-17(12-23)10-14(11-17)22-7-4-13(5-8-22)15-18-19-20-21(15)2/h13-14H,3-12H2,1-2H3 |
| InChIKey | LMQIXTQXSFVDSI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |