C21H29BrN2O4 — CID 175879760
butyl 2-[3-(bromomethyl)-4-methoxycarbonylphenyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 175879760) has the molecular formula C21H29BrN2O4 and a molecular weight of 453.38 g/mol. Its IUPAC name is butyl 2-[3-(bromomethyl)-4-methoxycarbonylphenyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | butyl 2-[3-(bromomethyl)-4-methoxycarbonylphenyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 175879760 |
| Molecular Formula | C21H29BrN2O4 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | butyl 2-[3-(bromomethyl)-4-methoxycarbonylphenyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)CN(c1ccc(C(=O)OC)c(CBr)c1)C2 |
| InChI | InChI=1S/C21H29BrN2O4/c1-3-4-11-28-20(26)23-9-7-21(8-10-23)14-24(15-21)17-5-6-18(19(25)27-2)16(12-17)13-22/h5-6,12H,3-4,7-11,13-15H2,1-2H3 |
| InChIKey | VCAJEHHFTUEROJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|