C19H25F3N2O4 — CID 135387861
butyl 4-[[3-methoxycarbonyl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 135387861) has the molecular formula C19H25F3N2O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is butyl 4-[[3-methoxycarbonyl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[[3-methoxycarbonyl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 135387861 |
| Molecular Formula | C19H25F3N2O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | butyl 4-[[3-methoxycarbonyl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(Cc2ccc(C(F)(F)F)c(C(=O)OC)c2)CC1 |
| InChI | InChI=1S/C19H25F3N2O4/c1-3-4-11-28-18(26)24-9-7-23(8-10-24)13-14-5-6-16(19(20,21)22)15(12-14)17(25)27-2/h5-6,12H,3-4,7-11,13H2,1-2H3 |
| InChIKey | JQQSIWWYKZTRTA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|