C13H17F3N4O — CID 151099376
5-(piperazin-1-ylmethyl)-2-(trifluoromethyl)benzohydrazide (PubChem CID 151099376) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is 5-(piperazin-1-ylmethyl)-2-(trifluoromethyl)benzohydrazide.
| Compound Name | 5-(piperazin-1-ylmethyl)-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 151099376 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-(piperazin-1-ylmethyl)-2-(trifluoromethyl)benzohydrazide |
| SMILES | NNC(=O)c1cc(CN2CCNCC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H17F3N4O/c14-13(15,16)11-2-1-9(7-10(11)12(21)19-17)8-20-5-3-18-4-6-20/h1-2,7,18H,3-6,8,17H2,(H,19,21) |
| InChIKey | MNUKRHGRBJIKID-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|