C17H24F4N2O2 — CID 174629991
tert-butyl formate;1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 174629991) has the molecular formula C17H24F4N2O2 and a molecular weight of 364.38 g/mol. Its IUPAC name is tert-butyl formate;1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | tert-butyl formate;1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 174629991 |
| Molecular Formula | C17H24F4N2O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | tert-butyl formate;1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | CC(C)(C)OC=O.Fc1ccc(CN2CCNCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14F4N2.C5H10O2/c13-11-2-1-9(7-10(11)12(14,15)16)8-18-5-3-17-4-6-18;1-5(2,3)7-4-6/h1-2,7,17H,3-6,8H2;4H,1-3H3 |
| InChIKey | XHJJVNKCUOOMEL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|