C18H31N3O2 — CID 174941750
tert-butyl formate;1-[4-(piperazin-1-ylmethyl)phenyl]ethanamine (PubChem CID 174941750) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is tert-butyl formate;1-[4-(piperazin-1-ylmethyl)phenyl]ethanamine.
| Compound Name | tert-butyl formate;1-[4-(piperazin-1-ylmethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 174941750 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | tert-butyl formate;1-[4-(piperazin-1-ylmethyl)phenyl]ethanamine |
| SMILES | CC(C)(C)OC=O.CC(N)c1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C13H21N3.C5H10O2/c1-11(14)13-4-2-12(3-5-13)10-16-8-6-15-7-9-16;1-5(2,3)7-4-6/h2-5,11,15H,6-10,14H2,1H3;4H,1-3H3 |
| InChIKey | DLFSHMDRMWNJLI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|