C11H26N4O4S — CID 158977664
tert-butyl formate;1-[2-(sulfamoylamino)ethyl]piperazine (PubChem CID 158977664) has the molecular formula C11H26N4O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is tert-butyl formate;1-[2-(sulfamoylamino)ethyl]piperazine.
| Compound Name | tert-butyl formate;1-[2-(sulfamoylamino)ethyl]piperazine |
|---|---|
| PubChem CID | 158977664 |
| Molecular Formula | C11H26N4O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl formate;1-[2-(sulfamoylamino)ethyl]piperazine |
| SMILES | CC(C)(C)OC=O.NS(=O)(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C6H16N4O2S.C5H10O2/c7-13(11,12)9-3-6-10-4-1-8-2-5-10;1-5(2,3)7-4-6/h8-9H,1-6H2,(H2,7,11,12);4H,1-3H3 |
| InChIKey | JOPDSQNJSPSGLC-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|