C22H45N5O4 — CID 175303699
tert-butyl formate;methyl 1-(2-piperazin-1-ylethyl)piperidine-4-carboxylate;piperazine (PubChem CID 175303699) has the molecular formula C22H45N5O4 and a molecular weight of 443.63 g/mol. Its IUPAC name is tert-butyl formate;methyl 1-(2-piperazin-1-ylethyl)piperidine-4-carboxylate;piperazine.
| Compound Name | tert-butyl formate;methyl 1-(2-piperazin-1-ylethyl)piperidine-4-carboxylate;piperazine |
|---|---|
| PubChem CID | 175303699 |
| Molecular Formula | C22H45N5O4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.35 |
| IUPAC Name | tert-butyl formate;methyl 1-(2-piperazin-1-ylethyl)piperidine-4-carboxylate;piperazine |
| SMILES | C1CNCCN1.CC(C)(C)OC=O.COC(=O)C1CCN(CCN2CCNCC2)CC1 |
| InChI | InChI=1S/C13H25N3O2.C5H10O2.C4H10N2/c1-18-13(17)12-2-6-15(7-3-12)10-11-16-8-4-14-5-9-16;1-5(2,3)7-4-6;1-2-6-4-3-5-1/h12,14H,2-11H2,1H3;4H,1-3H3;5-6H,1-4H2 |
| InChIKey | KUFSZPVKONTOIN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|