About tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate
tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate (PubChem CID 157272887) has the molecular formula C18H30N2O5S
and a molecular weight of 386.51 g/mol. Its IUPAC name is tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate |
| PubChem CID | 157272887 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate |
| SMILES | CC(C)(C)OC=O.Cc1ccc(S(=O)(=O)OCCN2CCNCC2)cc1 |
| InChI | InChI=1S/C13H20N2O3S.C5H10O2/c1-12-2-4-13(5-3-12)19(16,17)18-11-10-15-8-6-14-7-9-15;1-5(2,3)7-4-6/h2-5,14H,6-11H2,1H3;4H,1-3H3 |
| InChIKey | AYTAXRLOZZMVSG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate?
The IUPAC name of tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate (CID 157272887) is tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate.
What is the SMILES notation for tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate?
The canonical SMILES for tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate is CC(C)(C)OC=O.Cc1ccc(S(=O)(=O)OCCN2CCNCC2)cc1.
What is the InChIKey of tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate?
The InChIKey is AYTAXRLOZZMVSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3S.C5H10O2/c1-12-2-4-13(5-3-12)19(16,17)18-11-10-15-8-6-14-7-9-15;1-5(2,3)7-4-6/h2-5,14H,6-11H2,1H3;4H,1-3H3.
What are the key properties of tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate?
tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate has a molecular weight of 386.51 g/mol, XLogP of 1.56, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;2-piperazin-1-ylethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 157272887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).