C22H37N3O2 — CID 174747140
tert-butyl formate;1-[(2-methyl-3-piperidin-1-ylphenyl)methyl]piperazine (PubChem CID 174747140) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is tert-butyl formate;1-[(2-methyl-3-piperidin-1-ylphenyl)methyl]piperazine.
| Compound Name | tert-butyl formate;1-[(2-methyl-3-piperidin-1-ylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 174747140 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | tert-butyl formate;1-[(2-methyl-3-piperidin-1-ylphenyl)methyl]piperazine |
| SMILES | CC(C)(C)OC=O.Cc1c(CN2CCNCC2)cccc1N1CCCCC1 |
| InChI | InChI=1S/C17H27N3.C5H10O2/c1-15-16(14-19-12-8-18-9-13-19)6-5-7-17(15)20-10-3-2-4-11-20;1-5(2,3)7-4-6/h5-7,18H,2-4,8-14H2,1H3;4H,1-3H3 |
| InChIKey | JCVHZPHLESPJHB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|