C17H24F3N3O4 — CID 159053424
tert-butyl formate;1-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 159053424) has the molecular formula C17H24F3N3O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is tert-butyl formate;1-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | tert-butyl formate;1-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 159053424 |
| Molecular Formula | C17H24F3N3O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | tert-butyl formate;1-[[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | CC(C)(C)OC=O.O=[N+]([O-])c1ccc(CN2CCNCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N3O2.C5H10O2/c13-12(14,15)11-7-10(18(19)20)2-1-9(11)8-17-5-3-16-4-6-17;1-5(2,3)7-4-6/h1-2,7,16H,3-6,8H2;4H,1-3H3 |
| InChIKey | JXOHMLJSSMVWLW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|