C18H26F3N3O4 — CID 174586622
tert-butyl formate;3,5-dimethyl-1-[4-nitro-2-(trifluoromethyl)phenyl]piperazine (PubChem CID 174586622) has the molecular formula C18H26F3N3O4 and a molecular weight of 405.42 g/mol. Its IUPAC name is tert-butyl formate;3,5-dimethyl-1-[4-nitro-2-(trifluoromethyl)phenyl]piperazine.
| Compound Name | tert-butyl formate;3,5-dimethyl-1-[4-nitro-2-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 174586622 |
| Molecular Formula | C18H26F3N3O4 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | tert-butyl formate;3,5-dimethyl-1-[4-nitro-2-(trifluoromethyl)phenyl]piperazine |
| SMILES | CC(C)(C)OC=O.CC1CN(c2ccc([N+](=O)[O-])cc2C(F)(F)F)CC(C)N1 |
| InChI | InChI=1S/C13H16F3N3O2.C5H10O2/c1-8-6-18(7-9(2)17-8)12-4-3-10(19(20)21)5-11(12)13(14,15)16;1-5(2,3)7-4-6/h3-5,8-9,17H,6-7H2,1-2H3;4H,1-3H3 |
| InChIKey | ICSHSXZFNGLFBC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|