C12H18N4O2 — CID 171982408
2-(3,5-dimethylpiperazin-1-yl)-5-nitroaniline (PubChem CID 171982408) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperazin-1-yl)-5-nitroaniline.
| Compound Name | 2-(3,5-dimethylpiperazin-1-yl)-5-nitroaniline |
|---|---|
| PubChem CID | 171982408 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-(3,5-dimethylpiperazin-1-yl)-5-nitroaniline |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2N)CC(C)N1 |
| InChI | InChI=1S/C12H18N4O2/c1-8-6-15(7-9(2)14-8)12-4-3-10(16(17)18)5-11(12)13/h3-5,8-9,14H,6-7,13H2,1-2H3 |
| InChIKey | PVVMAZPMOFXXOE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|