C12H17N3O3 — CID 62506629
2-(2,5-dimethylmorpholin-4-yl)-5-nitroaniline (PubChem CID 62506629) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-(2,5-dimethylmorpholin-4-yl)-5-nitroaniline.
| Compound Name | 2-(2,5-dimethylmorpholin-4-yl)-5-nitroaniline |
|---|---|
| PubChem CID | 62506629 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(2,5-dimethylmorpholin-4-yl)-5-nitroaniline |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2N)C(C)CO1 |
| InChI | InChI=1S/C12H17N3O3/c1-8-7-18-9(2)6-14(8)12-4-3-10(15(16)17)5-11(12)13/h3-5,8-9H,6-7,13H2,1-2H3 |
| InChIKey | ZMRCTHZOALOJPQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|