C15H19N3O — CID 103137270
8-(2,5-dimethylmorpholin-4-yl)isoquinolin-5-amine (PubChem CID 103137270) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 8-(2,5-dimethylmorpholin-4-yl)isoquinolin-5-amine.
| Compound Name | 8-(2,5-dimethylmorpholin-4-yl)isoquinolin-5-amine |
|---|---|
| PubChem CID | 103137270 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 8-(2,5-dimethylmorpholin-4-yl)isoquinolin-5-amine |
| SMILES | CC1CN(c2ccc(N)c3ccncc23)C(C)CO1 |
| InChI | InChI=1S/C15H19N3O/c1-10-9-19-11(2)8-18(10)15-4-3-14(16)12-5-6-17-7-13(12)15/h3-7,10-11H,8-9,16H2,1-2H3 |
| InChIKey | SQGMZERPKLMKMD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|