C16H21N3 — CID 103139285
8-(3,4-dimethylpiperidin-1-yl)isoquinolin-5-amine (PubChem CID 103139285) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 8-(3,4-dimethylpiperidin-1-yl)isoquinolin-5-amine.
| Compound Name | 8-(3,4-dimethylpiperidin-1-yl)isoquinolin-5-amine |
|---|---|
| PubChem CID | 103139285 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 8-(3,4-dimethylpiperidin-1-yl)isoquinolin-5-amine |
| SMILES | CC1CCN(c2ccc(N)c3ccncc23)CC1C |
| InChI | InChI=1S/C16H21N3/c1-11-6-8-19(10-12(11)2)16-4-3-15(17)13-5-7-18-9-14(13)16/h3-5,7,9,11-12H,6,8,10,17H2,1-2H3 |
| InChIKey | WCAODJRNXNAETE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|