C9H16N4O — CID 82234573
4-(2,5-dimethylmorpholin-4-yl)-1H-pyrazol-5-amine (PubChem CID 82234573) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(2,5-dimethylmorpholin-4-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2,5-dimethylmorpholin-4-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 82234573 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-(2,5-dimethylmorpholin-4-yl)-1H-pyrazol-5-amine |
| SMILES | CC1CN(c2cn[nH]c2N)C(C)CO1 |
| InChI | InChI=1S/C9H16N4O/c1-6-5-14-7(2)4-13(6)8-3-11-12-9(8)10/h3,6-7H,4-5H2,1-2H3,(H3,10,11,12) |
| InChIKey | DMTQKWKKDKDIHI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |