C12H17N3O2 — CID 7059973
(3R,5R)-3,5-dimethyl-1-(2-nitrophenyl)piperazine (PubChem CID 7059973) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-1-(2-nitrophenyl)piperazine.
| Compound Name | (3R,5R)-3,5-dimethyl-1-(2-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 7059973 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-1-(2-nitrophenyl)piperazine |
| SMILES | C[C@@H]1CN(c2ccccc2[N+](=O)[O-])C[C@@H](C)N1 |
| InChI | InChI=1S/C12H17N3O2/c1-9-7-14(8-10(2)13-9)11-5-3-4-6-12(11)15(16)17/h3-6,9-10,13H,7-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | WJUYWKJVECSDQD-NXEZZACHSA-N |
| XLogP | 1.78 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|