C13H17N5O2 — CID 162715701
3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-nitro-1H-indazole (PubChem CID 162715701) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-nitro-1H-indazole.
| Compound Name | 3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-nitro-1H-indazole |
|---|---|
| PubChem CID | 162715701 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-nitro-1H-indazole |
| SMILES | C[C@@H]1CN(c2n[nH]c3cc([N+](=O)[O-])ccc23)C[C@H](C)N1 |
| InChI | InChI=1S/C13H17N5O2/c1-8-6-17(7-9(2)14-8)13-11-4-3-10(18(19)20)5-12(11)15-16-13/h3-5,8-9,14H,6-7H2,1-2H3,(H,15,16)/t8-,9+ |
| InChIKey | WHYMUWDMDCPMCX-DTORHVGOSA-N |
| XLogP | 1.66 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|