C17H23F3N4O4 — CID 141381072
tert-butyl N-[4-[dideuterio-[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]carbamate (PubChem CID 141381072) has the molecular formula C17H23F3N4O4 and a molecular weight of 406.40 g/mol. Its IUPAC name is tert-butyl N-[4-[dideuterio-[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[dideuterio-[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]carbamate |
|---|---|
| PubChem CID | 141381072 |
| Molecular Formula | C17H23F3N4O4 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | tert-butyl N-[4-[dideuterio-[4-nitro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]carbamate |
| SMILES | [2H]C([2H])(c1ccc([N+](=O)[O-])cc1C(F)(F)F)N1CCN(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H23F3N4O4/c1-16(2,3)28-15(25)21-23-8-6-22(7-9-23)11-12-4-5-13(24(26)27)10-14(12)17(18,19)20/h4-5,10H,6-9,11H2,1-3H3,(H,21,25)/i11D2 |
| InChIKey | DJBTYZXYJWGTLD-ZWGOZCLVSA-N |
| XLogP | 3.17 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|