C13H15ClF3NO2 — CID 63530543
1-(2-chloro-3,3-dimethylbutyl)-4-nitro-2-(trifluoromethyl)benzene (PubChem CID 63530543) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.72 g/mol. Its IUPAC name is 1-(2-chloro-3,3-dimethylbutyl)-4-nitro-2-(trifluoromethyl)benzene.
| Compound Name | 1-(2-chloro-3,3-dimethylbutyl)-4-nitro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 63530543 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 1-(2-chloro-3,3-dimethylbutyl)-4-nitro-2-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)C(Cl)Cc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C13H15ClF3NO2/c1-12(2,3)11(14)6-8-4-5-9(18(19)20)7-10(8)13(15,16)17/h4-5,7,11H,6H2,1-3H3 |
| InChIKey | YNBJLSTUNAOPEQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|