C12H12F3NO4 — CID 90422452
2,2-dimethyl-3-[4-nitro-2-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 90422452) has the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-nitro-2-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[4-nitro-2-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 90422452 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2,2-dimethyl-3-[4-nitro-2-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(C)(Cc1ccc([N+](=O)[O-])cc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H12F3NO4/c1-11(2,10(17)18)6-7-3-4-8(16(19)20)5-9(7)12(13,14)15/h3-5H,6H2,1-2H3,(H,17,18) |
| InChIKey | KONNARBVMXWYHL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|