C25H26F6N4O6 — CID 20562828
N,N'-bis[2-methyl-3-[4-nitro-2-(trifluoromethyl)phenyl]propyl]propanediamide (PubChem CID 20562828) has the molecular formula C25H26F6N4O6 and a molecular weight of 592.49 g/mol. Its IUPAC name is N,N'-bis[2-methyl-3-[4-nitro-2-(trifluoromethyl)phenyl]propyl]propanediamide.
| Compound Name | N,N'-bis[2-methyl-3-[4-nitro-2-(trifluoromethyl)phenyl]propyl]propanediamide |
|---|---|
| PubChem CID | 20562828 |
| Molecular Formula | C25H26F6N4O6 |
| Molecular Weight | 592.49 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | N,N'-bis[2-methyl-3-[4-nitro-2-(trifluoromethyl)phenyl]propyl]propanediamide |
| SMILES | CC(CNC(=O)CC(=O)NCC(C)Cc1ccc([N+](=O)[O-])cc1C(F)(F)F)Cc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C25H26F6N4O6/c1-14(7-16-3-5-18(34(38)39)9-20(16)24(26,27)28)12-32-22(36)11-23(37)33-13-15(2)8-17-4-6-19(35(40)41)10-21(17)25(29,30)31/h3-6,9-10,14-15H,7-8,11-13H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | RVTRVRYXWDSNCC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|