C20H28F3N3O7 — CID 174741770
tert-butyl formate;ethyl 2-nitro-4-(piperazin-1-ylmethyl)-5-(trifluoromethoxy)benzoate (PubChem CID 174741770) has the molecular formula C20H28F3N3O7 and a molecular weight of 479.45 g/mol. Its IUPAC name is tert-butyl formate;ethyl 2-nitro-4-(piperazin-1-ylmethyl)-5-(trifluoromethoxy)benzoate.
| Compound Name | tert-butyl formate;ethyl 2-nitro-4-(piperazin-1-ylmethyl)-5-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 174741770 |
| Molecular Formula | C20H28F3N3O7 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | tert-butyl formate;ethyl 2-nitro-4-(piperazin-1-ylmethyl)-5-(trifluoromethoxy)benzoate |
| SMILES | CC(C)(C)OC=O.CCOC(=O)c1cc(OC(F)(F)F)c(CN2CCNCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18F3N3O5.C5H10O2/c1-2-25-14(22)11-8-13(26-15(16,17)18)10(7-12(11)21(23)24)9-20-5-3-19-4-6-20;1-5(2,3)7-4-6/h7-8,19H,2-6,9H2,1H3;4H,1-3H3 |
| InChIKey | HRNNGZOQTLMDNV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|