About tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate
tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate (PubChem CID 174618782) has the molecular formula C18H28ClN3O4
and a molecular weight of 385.89 g/mol. Its IUPAC name is tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate |
| PubChem CID | 174618782 |
| Molecular Formula | C18H28ClN3O4 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate |
| SMILES | CC(C)(C)OC=O.CCOC(=O)c1cc(N2CCNCC2)nc(Cl)c1C |
| InChI | InChI=1S/C13H18ClN3O2.C5H10O2/c1-3-19-13(18)10-8-11(16-12(14)9(10)2)17-6-4-15-5-7-17;1-5(2,3)7-4-6/h8,15H,3-7H2,1-2H3;4H,1-3H3 |
| InChIKey | ASEPZOXWFVNJDS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate?
The IUPAC name of tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate (CID 174618782) is tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate.
What is the SMILES notation for tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate?
The canonical SMILES for tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate is CC(C)(C)OC=O.CCOC(=O)c1cc(N2CCNCC2)nc(Cl)c1C.
What is the InChIKey of tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate?
The InChIKey is ASEPZOXWFVNJDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClN3O2.C5H10O2/c1-3-19-13(18)10-8-11(16-12(14)9(10)2)17-6-4-15-5-7-17;1-5(2,3)7-4-6/h8,15H,3-7H2,1-2H3;4H,1-3H3.
What are the key properties of tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate?
tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate has a molecular weight of 385.89 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate is sourced from PubChem (CID 174618782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).