C18H28ClN3O4 — CID 174618782
tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate (PubChem CID 174618782) has the molecular formula C18H28ClN3O4 and a molecular weight of 385.89 g/mol. Its IUPAC name is tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate.
| Compound Name | tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 174618782 |
| Molecular Formula | C18H28ClN3O4 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | tert-butyl formate;ethyl 2-chloro-3-methyl-6-piperazin-1-ylpyridine-4-carboxylate |
| SMILES | CC(C)(C)OC=O.CCOC(=O)c1cc(N2CCNCC2)nc(Cl)c1C |
| InChI | InChI=1S/C13H18ClN3O2.C5H10O2/c1-3-19-13(18)10-8-11(16-12(14)9(10)2)17-6-4-15-5-7-17;1-5(2,3)7-4-6/h8,15H,3-7H2,1-2H3;4H,1-3H3 |
| InChIKey | ASEPZOXWFVNJDS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|