C12H20ClN5O2 — CID 159878088
tert-butyl formate;2-chloro-4-piperazin-1-yl-1,3,5-triazine (PubChem CID 159878088) has the molecular formula C12H20ClN5O2 and a molecular weight of 301.78 g/mol. Its IUPAC name is tert-butyl formate;2-chloro-4-piperazin-1-yl-1,3,5-triazine.
| Compound Name | tert-butyl formate;2-chloro-4-piperazin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 159878088 |
| Molecular Formula | C12H20ClN5O2 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | tert-butyl formate;2-chloro-4-piperazin-1-yl-1,3,5-triazine |
| SMILES | CC(C)(C)OC=O.Clc1ncnc(N2CCNCC2)n1 |
| InChI | InChI=1S/C7H10ClN5.C5H10O2/c8-6-10-5-11-7(12-6)13-3-1-9-2-4-13;1-5(2,3)7-4-6/h5,9H,1-4H2;4H,1-3H3 |
| InChIKey | NTEBHWIXEUOLCO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|