C16H23N3O2S2 — CID 161061664
tert-butyl formate;2-piperazin-1-yl-5-thiophen-2-yl-1,3-thiazole (PubChem CID 161061664) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is tert-butyl formate;2-piperazin-1-yl-5-thiophen-2-yl-1,3-thiazole.
| Compound Name | tert-butyl formate;2-piperazin-1-yl-5-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 161061664 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | tert-butyl formate;2-piperazin-1-yl-5-thiophen-2-yl-1,3-thiazole |
| SMILES | CC(C)(C)OC=O.c1csc(-c2cnc(N3CCNCC3)s2)c1 |
| InChI | InChI=1S/C11H13N3S2.C5H10O2/c1-2-9(15-7-1)10-8-13-11(16-10)14-5-3-12-4-6-14;1-5(2,3)7-4-6/h1-2,7-8,12H,3-6H2;4H,1-3H3 |
| InChIKey | UDMAMLOTXRPDOR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|