C18H28N4O2 — CID 162125221
tert-butyl formate;7-(1-piperazin-1-ylethyl)imidazo[1,2-a]pyridine (PubChem CID 162125221) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is tert-butyl formate;7-(1-piperazin-1-ylethyl)imidazo[1,2-a]pyridine.
| Compound Name | tert-butyl formate;7-(1-piperazin-1-ylethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 162125221 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl formate;7-(1-piperazin-1-ylethyl)imidazo[1,2-a]pyridine |
| SMILES | CC(C)(C)OC=O.CC(c1ccn2ccnc2c1)N1CCNCC1 |
| InChI | InChI=1S/C13H18N4.C5H10O2/c1-11(16-7-3-14-4-8-16)12-2-6-17-9-5-15-13(17)10-12;1-5(2,3)7-4-6/h2,5-6,9-11,14H,3-4,7-8H2,1H3;4H,1-3H3 |
| InChIKey | ZHXXGULSXRSPNO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|