C12H16I2N2 — CID 118911318
1-[1-(3,4-diiodophenyl)ethyl]piperazine (PubChem CID 118911318) has the molecular formula C12H16I2N2 and a molecular weight of 442.08 g/mol. Its IUPAC name is 1-[1-(3,4-diiodophenyl)ethyl]piperazine.
| Compound Name | 1-[1-(3,4-diiodophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 118911318 |
| Molecular Formula | C12H16I2N2 |
| Molecular Weight | 442.08 g/mol |
| Exact Mass | 441.94 |
| IUPAC Name | 1-[1-(3,4-diiodophenyl)ethyl]piperazine |
| SMILES | CC(c1ccc(I)c(I)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H16I2N2/c1-9(16-6-4-15-5-7-16)10-2-3-11(13)12(14)8-10/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | XFXPSYNMISUXRD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.08 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|