C12H16I2N2O — CID 171283859
2,6-diiodo-4-[(1S)-1-piperazin-1-ylethyl]phenol (PubChem CID 171283859) has the molecular formula C12H16I2N2O and a molecular weight of 458.08 g/mol. Its IUPAC name is 2,6-diiodo-4-[(1S)-1-piperazin-1-ylethyl]phenol.
| Compound Name | 2,6-diiodo-4-[(1S)-1-piperazin-1-ylethyl]phenol |
|---|---|
| PubChem CID | 171283859 |
| Molecular Formula | C12H16I2N2O |
| Molecular Weight | 458.08 g/mol |
| Exact Mass | 457.94 |
| IUPAC Name | 2,6-diiodo-4-[(1S)-1-piperazin-1-ylethyl]phenol |
| SMILES | C[C@@H](c1cc(I)c(O)c(I)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H16I2N2O/c1-8(16-4-2-15-3-5-16)9-6-10(13)12(17)11(14)7-9/h6-8,15,17H,2-5H2,1H3/t8-/m0/s1 |
| InChIKey | FCJNJHZLPAKWPT-QMMMGPOBSA-N |
| XLogP | 2.57 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.08 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|