C7H10ClN5 — CID 54357139
2-chloro-4-piperazin-1-yl-1,3,5-triazine (PubChem CID 54357139) has the molecular formula C7H10ClN5 and a molecular weight of 199.64 g/mol. Its IUPAC name is 2-chloro-4-piperazin-1-yl-1,3,5-triazine.
| Compound Name | 2-chloro-4-piperazin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 54357139 |
| Molecular Formula | C7H10ClN5 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-chloro-4-piperazin-1-yl-1,3,5-triazine |
| SMILES | Clc1ncnc(N2CCNCC2)n1 |
| InChI | InChI=1S/C7H10ClN5/c8-6-10-5-11-7(12-6)13-3-1-9-2-4-13/h5,9H,1-4H2 |
| InChIKey | UJWSZMSYWCRILM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |