C14H14Cl2N4 — CID 103278321
4-(2,4-dichlorophenyl)-2-piperazin-1-ylpyrimidine (PubChem CID 103278321) has the molecular formula C14H14Cl2N4 and a molecular weight of 309.20 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-piperazin-1-ylpyrimidine.
| Compound Name | 4-(2,4-dichlorophenyl)-2-piperazin-1-ylpyrimidine |
|---|---|
| PubChem CID | 103278321 |
| Molecular Formula | C14H14Cl2N4 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-piperazin-1-ylpyrimidine |
| SMILES | Clc1ccc(-c2ccnc(N3CCNCC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N4/c15-10-1-2-11(12(16)9-10)13-3-4-18-14(19-13)20-7-5-17-6-8-20/h1-4,9,17H,5-8H2 |
| InChIKey | ZIIFDGYRNHUVCV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |