C12H20N6 — CID 6610945
2,4-di(piperazin-1-yl)pyrimidine (PubChem CID 6610945) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2,4-di(piperazin-1-yl)pyrimidine.
| Compound Name | 2,4-di(piperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 6610945 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2,4-di(piperazin-1-yl)pyrimidine |
| SMILES | c1cc(N2CCNCC2)nc(N2CCNCC2)n1 |
| InChI | InChI=1S/C12H20N6/c1-2-15-12(18-9-5-14-6-10-18)16-11(1)17-7-3-13-4-8-17/h1-2,13-14H,3-10H2 |
| InChIKey | DFWOUSSTLCHQHL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |