C9H15N5 — CID 80838050
N-methyl-4-piperazin-1-ylpyrimidin-2-amine (PubChem CID 80838050) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-methyl-4-piperazin-1-ylpyrimidin-2-amine.
| Compound Name | N-methyl-4-piperazin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80838050 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-methyl-4-piperazin-1-ylpyrimidin-2-amine |
| SMILES | CNc1nccc(N2CCNCC2)n1 |
| InChI | InChI=1S/C9H15N5/c1-10-9-12-3-2-8(13-9)14-6-4-11-5-7-14/h2-3,11H,4-7H2,1H3,(H,10,12,13) |
| InChIKey | JEIHXNYPJNYSJL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |