C7H11N5 — CID 2760673
2-piperazin-1-yl-1,3,5-triazine (PubChem CID 2760673) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-piperazin-1-yl-1,3,5-triazine.
| Compound Name | 2-piperazin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 2760673 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 2-piperazin-1-yl-1,3,5-triazine |
| SMILES | c1ncnc(N2CCNCC2)n1 |
| InChI | InChI=1S/C7H11N5/c1-3-12(4-2-8-1)7-10-5-9-6-11-7/h5-6,8H,1-4H2 |
| InChIKey | QKOFSFOOALTCPW-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |