About heptane;2-piperazin-1-ylpyrimidine
heptane;2-piperazin-1-ylpyrimidine (PubChem CID 144585904) has the molecular formula C15H28N4
and a molecular weight of 264.42 g/mol. Its IUPAC name is heptane;2-piperazin-1-ylpyrimidine.
Molecular Properties
| Compound Name | heptane;2-piperazin-1-ylpyrimidine |
| PubChem CID | 144585904 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | heptane;2-piperazin-1-ylpyrimidine |
| SMILES | CCCCCCC.c1cnc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C8H12N4.C7H16/c1-2-10-8(11-3-1)12-6-4-9-5-7-12;1-3-5-7-6-4-2/h1-3,9H,4-7H2;3-7H2,1-2H3 |
| InChIKey | XGKVFALYOMQMEI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptane;2-piperazin-1-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;2-piperazin-1-ylpyrimidine?
The IUPAC name of heptane;2-piperazin-1-ylpyrimidine (CID 144585904) is heptane;2-piperazin-1-ylpyrimidine.
What is the SMILES notation for heptane;2-piperazin-1-ylpyrimidine?
The canonical SMILES for heptane;2-piperazin-1-ylpyrimidine is CCCCCCC.c1cnc(N2CCNCC2)nc1.
What is the InChIKey of heptane;2-piperazin-1-ylpyrimidine?
The InChIKey is XGKVFALYOMQMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4.C7H16/c1-2-10-8(11-3-1)12-6-4-9-5-7-12;1-3-5-7-6-4-2/h1-3,9H,4-7H2;3-7H2,1-2H3.
What are the key properties of heptane;2-piperazin-1-ylpyrimidine?
heptane;2-piperazin-1-ylpyrimidine has a molecular weight of 264.42 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;2-piperazin-1-ylpyrimidine is sourced from PubChem (CID 144585904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).