About piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride
piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride (PubChem CID 174800980) has the molecular formula C13H24FN5
and a molecular weight of 269.37 g/mol. Its IUPAC name is piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride.
Molecular Properties
| Compound Name | piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride |
| PubChem CID | 174800980 |
| Molecular Formula | C13H24FN5 |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride |
| SMILES | C1CNCCN1.F.c1cnc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C9H13N3.C4H10N2.FH/c1-2-7-12(8-3-1)9-10-5-4-6-11-9;1-2-6-4-3-5-1;/h4-6H,1-3,7-8H2;5-6H,1-4H2;1H |
| InChIKey | BGNOHUTYNJMWRH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride?
The IUPAC name of piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride (CID 174800980) is piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride.
What is the SMILES notation for piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride?
The canonical SMILES for piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride is C1CNCCN1.F.c1cnc(N2CCCCC2)nc1.
What is the InChIKey of piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride?
The InChIKey is BGNOHUTYNJMWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3.C4H10N2.FH/c1-2-7-12(8-3-1)9-10-5-4-6-11-9;1-2-6-4-3-5-1;/h4-6H,1-3,7-8H2;5-6H,1-4H2;1H.
What are the key properties of piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride?
piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride has a molecular weight of 269.37 g/mol, XLogP of 0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;2-piperidin-1-ylpyrimidine;hydrofluoride is sourced from PubChem (CID 174800980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).