C8H13N5 — CID 82468295
2-(piperazin-1-ylmethyl)-1,3,5-triazine (PubChem CID 82468295) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 2-(piperazin-1-ylmethyl)-1,3,5-triazine.
| Compound Name | 2-(piperazin-1-ylmethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 82468295 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 2-(piperazin-1-ylmethyl)-1,3,5-triazine |
| SMILES | c1ncnc(CN2CCNCC2)n1 |
| InChI | InChI=1S/C8H13N5/c1-3-13(4-2-9-1)5-8-11-6-10-7-12-8/h6-7,9H,1-5H2 |
| InChIKey | SKATXOGLMIFYAE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |