About 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine
5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine (PubChem CID 82470457) has the molecular formula C10H17N5
and a molecular weight of 207.28 g/mol. Its IUPAC name is 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine.
Molecular Properties
| Compound Name | 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine |
| PubChem CID | 82470457 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine |
| SMILES | Cc1nnc(CN2CCNCC2)nc1C |
| InChI | InChI=1S/C10H17N5/c1-8-9(2)13-14-10(12-8)7-15-5-3-11-4-6-15/h11H,3-7H2,1-2H3 |
| InChIKey | NOEBJCAYHDVHSX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine?
The IUPAC name of 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine (CID 82470457) is 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine.
What is the SMILES notation for 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine?
The canonical SMILES for 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine is Cc1nnc(CN2CCNCC2)nc1C.
What is the InChIKey of 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine?
The InChIKey is NOEBJCAYHDVHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5/c1-8-9(2)13-14-10(12-8)7-15-5-3-11-4-6-15/h11H,3-7H2,1-2H3.
What are the key properties of 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine?
5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine has a molecular weight of 207.28 g/mol, XLogP of -0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3-(piperazin-1-ylmethyl)-1,2,4-triazine is sourced from PubChem (CID 82470457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).