C11H19N3S — CID 82509839
4-ethyl-2-methyl-5-(piperazin-1-ylmethyl)-1,3-thiazole (PubChem CID 82509839) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 4-ethyl-2-methyl-5-(piperazin-1-ylmethyl)-1,3-thiazole.
| Compound Name | 4-ethyl-2-methyl-5-(piperazin-1-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 82509839 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4-ethyl-2-methyl-5-(piperazin-1-ylmethyl)-1,3-thiazole |
| SMILES | CCc1nc(C)sc1CN1CCNCC1 |
| InChI | InChI=1S/C11H19N3S/c1-3-10-11(15-9(2)13-10)8-14-6-4-12-5-7-14/h12H,3-8H2,1-2H3 |
| InChIKey | CRTXRQSIPZWRIL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |