C18H29N11O2 — CID 102513900
2-[2-[[4-piperazin-1-yl-6-[4-(1,3,5-triazin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethoxy]ethanol (PubChem CID 102513900) has the molecular formula C18H29N11O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-[2-[[4-piperazin-1-yl-6-[4-(1,3,5-triazin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[4-piperazin-1-yl-6-[4-(1,3,5-triazin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 102513900 |
| Molecular Formula | C18H29N11O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 2-[2-[[4-piperazin-1-yl-6-[4-(1,3,5-triazin-2-yl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1nc(N2CCNCC2)nc(N2CCN(c3ncncn3)CC2)n1 |
| InChI | InChI=1S/C18H29N11O2/c30-10-12-31-11-3-21-15-24-17(27-4-1-19-2-5-27)26-18(25-15)29-8-6-28(7-9-29)16-22-13-20-14-23-16/h13-14,19,30H,1-12H2,(H,21,24,25,26) |
| InChIKey | WZJSCBBSOCYJGV-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|