C11H13N5S — CID 67388017
2-piperazin-1-yl-4-thiophen-3-yl-1,3,5-triazine (PubChem CID 67388017) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is 2-piperazin-1-yl-4-thiophen-3-yl-1,3,5-triazine.
| Compound Name | 2-piperazin-1-yl-4-thiophen-3-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 67388017 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-piperazin-1-yl-4-thiophen-3-yl-1,3,5-triazine |
| SMILES | c1nc(-c2ccsc2)nc(N2CCNCC2)n1 |
| InChI | InChI=1S/C11H13N5S/c1-6-17-7-9(1)10-13-8-14-11(15-10)16-4-2-12-3-5-16/h1,6-8,12H,2-5H2 |
| InChIKey | QYESIGWJKFGXNV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |