C15H16N8 — CID 167940796
2-piperazin-1-yl-4-(5-pyrazol-1-yl-3-pyridinyl)-1,3,5-triazine (PubChem CID 167940796) has the molecular formula C15H16N8 and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-piperazin-1-yl-4-(5-pyrazol-1-yl-3-pyridinyl)-1,3,5-triazine.
| Compound Name | 2-piperazin-1-yl-4-(5-pyrazol-1-yl-3-pyridinyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 167940796 |
| Molecular Formula | C15H16N8 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-piperazin-1-yl-4-(5-pyrazol-1-yl-3-pyridinyl)-1,3,5-triazine |
| SMILES | c1cnn(-c2cncc(-c3ncnc(N4CCNCC4)n3)c2)c1 |
| InChI | InChI=1S/C15H16N8/c1-2-20-23(5-1)13-8-12(9-17-10-13)14-18-11-19-15(21-14)22-6-3-16-4-7-22/h1-2,5,8-11,16H,3-4,6-7H2 |
| InChIKey | AWKSUENQDLTOQH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |