C12H13N7S — CID 58446967
8-piperazin-1-yl-5-thiophen-3-yltetrazolo[1,5-a]pyrazine (PubChem CID 58446967) has the molecular formula C12H13N7S and a molecular weight of 287.35 g/mol. Its IUPAC name is 8-piperazin-1-yl-5-thiophen-3-yltetrazolo[1,5-a]pyrazine.
| Compound Name | 8-piperazin-1-yl-5-thiophen-3-yltetrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 58446967 |
| Molecular Formula | C12H13N7S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 8-piperazin-1-yl-5-thiophen-3-yltetrazolo[1,5-a]pyrazine |
| SMILES | c1cc(-c2cnc(N3CCNCC3)c3nnnn23)cs1 |
| InChI | InChI=1S/C12H13N7S/c1-6-20-8-9(1)10-7-14-11(12-15-16-17-19(10)12)18-4-2-13-3-5-18/h1,6-8,13H,2-5H2 |
| InChIKey | PCFZYJDGXBCOBP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |